120-61-6 Dimethyl terephthalate
Nama produk |
Dimethyl terephthalate |
Nama bahasa Inggris |
Dimethyl terephthalate; D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
MF |
C10H10O4 |
Berat Molekul |
194.184 |
InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
CAS NO |
120-61-6 |
EINECS |
204-411-8 |
Struktur Molekul |
|
Kepadatan |
1.175g/cm3 |
Titik lebur |
140-143℃ |
Titik didih |
282.7°C at 760 mmHg |
Indeks bias |
1.514 |
Titik nyala |
146.7°C |
Tekanan uap |
0.00331mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|