ChemNet > CAS > 1206-15-1 1-(4-Methoxyphenyl)-1-siklopentanekarbonitril
1206-15-1 1-(4-Methoxyphenyl)-1-siklopentanekarbonitril
| Nama produk |
1-(4-Methoxyphenyl)-1-siklopentanekarbonitril |
| Sinonim |
1- (4-Methoxyphenyl) siklopentanakarbonitril |
| Nama bahasa Inggris |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| MF |
C13H15NO |
| Berat Molekul |
201.2643 |
| InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| CAS NO |
1206-15-1 |
| EINECS |
214-890-5 |
| Struktur Molekul |
|
| Kepadatan |
1.07g/cm3 |
| Titik didih |
346.4°C at 760 mmHg |
| Indeks bias |
1.543 |
| Titik nyala |
146.2°C |
| Tekanan uap |
5.76E-05mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
