ChemNet > CAS > 127271-65-2 4-Fluoro-3-(trifluoromethyl)anisole
127271-65-2 4-Fluoro-3-(trifluoromethyl)anisole
Nama produk |
4-Fluoro-3-(trifluoromethyl)anisole |
Nama bahasa Inggris |
4-Fluoro-3-(trifluoromethyl)anisole; 2-Fluoro-5-methoxybenzotrifluoride; 4-fluoro-3-trifluoromethylanisole; 1-fluoro-4-methoxy-2-(trifluoromethyl)benzene; 4-bromo-2-fluoro-1-propoxybenzene; 3-Trifluoromethyl-4-Fluoroanisole; 2-Fluoro-5-(trifluoromethyl)anisole |
MF |
C9H10BrFO |
Berat Molekul |
233.0775 |
InChI |
InChI=1/C9H10BrFO/c1-2-5-12-9-4-3-7(10)6-8(9)11/h3-4,6H,2,5H2,1H3 |
CAS NO |
127271-65-2 |
Struktur Molekul |
|
Kepadatan |
1.397g/cm3 |
Titik didih |
251.471°C at 760 mmHg |
Indeks bias |
1.51 |
Titik nyala |
128.816°C |
Tekanan uap |
0.032mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|