ChemNet > CAS > 13074-65-2 Hexylcyclopentanone; 98%
13074-65-2 Hexylcyclopentanone; 98%
| Nama produk |
Hexylcyclopentanone; 98% |
| Nama bahasa Inggris |
Hexylcyclopentanone; 98%; 2-n-Hexylcyclopentanone; 2-hexylcyclopentanone |
| MF |
C11H20O |
| Berat Molekul |
168.2759 |
| InChI |
InChI=1/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h10H,2-9H2,1H3 |
| CAS NO |
13074-65-2 |
| EINECS |
235-970-6 |
| Struktur Molekul |
|
| Kepadatan |
0.891g/cm3 |
| Titik didih |
234.9°C at 760 mmHg |
| Indeks bias |
1.453 |
| Titik nyala |
88.6°C |
| Tekanan uap |
0.0517mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
