ChemNet > CAS > 13118-04-2 N,N'-o-Phenylenedimaleimide
13118-04-2 N,N'-o-Phenylenedimaleimide
Nama produk |
N,N'-o-Phenylenedimaleimide |
Sinonim |
; 1,2-Fenilen-bis-maleimida; 1,1'-benzena-1,2-diilbis (1H-pirol-2,5-dion) |
Nama bahasa Inggris |
N,N'-o-Phenylenedimaleimide; 1,2-Phenylene-bis-maleimide; 1,1'-benzene-1,2-diylbis(1H-pyrrole-2,5-dione) |
MF |
C14H8N2O4 |
Berat Molekul |
268.2243 |
InChI |
InChI=1/C14H8N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10(9)16-13(19)7-8-14(16)20/h1-8H |
CAS NO |
13118-04-2 |
EINECS |
236-046-5 |
Struktur Molekul |
|
Kepadatan |
1.567g/cm3 |
Titik lebur |
245-248℃ |
Titik didih |
459.7°C at 760 mmHg |
Indeks bias |
1.703 |
Titik nyala |
223.7°C |
Tekanan uap |
1.24E-08mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|