| Nama produk |
Gliseril monorisinoleat |
| Sinonim |
; Asam 9-Oktadecenoic, 12-hidroksi-, monoester dengan 1,2,3-propanatriol, (R-(Z))-; AI3-00967; UNII-ZUE0CEL42O; (R)-12-Asam hidroksolat, monoester dengan gliserol; Asam 9-Octadecenoic, 12-hidroksi-, (9Z,12R)-, monoester dengan 1,2,3-propanatriol; Asam 9-Octadecenoic, 12-hidroksi-, (R-(Z))-, monoester dengan 1,2,3-propanatriol; Asam 9-Octadecenoic, 12-hidroksi-, (theta-(Z))-, monoester dengan 1,2,3-propanatriol; 2,3-dihidroksipropil 12-hidroksioktadek-9-enoat; 2,3-dihidroksipropil (9Z,12R)-12-hidroksioktadek-9-enoat; 2,3-dihidroksipropil (Z)-12-hidroksioktadek-9-enoat |
| Nama bahasa Inggris |
Glyceryl monoricinoleate; 9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2,3-propanetriol, (R-(Z))-; AI3-00967; UNII-ZUE0CEL42O; (R)-12-Hydroxyoleic acid, monoester with glycerol; 9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, monoester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, (R-(Z))-, monoester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, (theta-(Z))-, monoester with 1,2,3-propanetriol; 2,3-dihydroxypropyl 12-hydroxyoctadec-9-enoate; 2,3-dihydroxypropyl (9Z,12R)-12-hydroxyoctadec-9-enoate; 2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate |
| MF |
C21H40O5 |
| Berat Molekul |
372.5393 |
| InChI |
InChI=1/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9-/t19-,20-/m1/s1 |
| CAS NO |
1323-38-2 |
| EINECS |
215-353-8 |
| Struktur Molekul |
|
| Kepadatan |
1.019g/cm3 |
| Titik didih |
520.5°C at 760 mmHg |
| Indeks bias |
1.49 |
| Titik nyala |
169.8°C |
| Tekanan uap |
5.19E-13mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
|
|
