ChemNet > CAS > 1323-42-8 asam hydroxyoctadecanoic, monoester dengan gliserol
1323-42-8 asam hydroxyoctadecanoic, monoester dengan gliserol
| Nama produk |
asam hydroxyoctadecanoic, monoester dengan gliserol |
| Sinonim |
Gliseril hidroksistearat; Asam hidroksistearat, monoester dengan gliserol; Asam stearat, hidroksi-, monoester dengan gliserol; Asam hydroxyoctadecanoic, monoester dengan gliserol; Asam oktadekanoat, hidroksi-, monoester dengan 1,2,3-propanatriol; 1,3-dihidroksipropan-2-yl 2-hidroksikoctadecanoate |
| Nama bahasa Inggris |
hydroxyoctadecanoic acid, monoester with glycerol;Glyceryl hydroxystearate; Hydroxystearic acid, monoester with glycerol; Stearic acid, hydroxy-, monoester with glycerol; Hydroxyoctadecanoic acid, monoester with glycerol; Octadecanoic acid, hydroxy-, monoester with 1,2,3-propanetriol; 1,3-dihydroxypropan-2-yl 2-hydroxyoctadecanoate |
| MF |
C21H42O5 |
| Berat Molekul |
374.5552 |
| InChI |
InChI=1/C21H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)21(25)26-19(17-22)18-23/h19-20,22-24H,2-18H2,1H3 |
| CAS NO |
1323-42-8 |
| EINECS |
215-355-9 |
| Struktur Molekul |
|
| Kepadatan |
1.007g/cm3 |
| Titik didih |
520.5°C at 760 mmHg |
| Indeks bias |
1.479 |
| Titik nyala |
168.9°C |
| Tekanan uap |
5.21E-13mmHg at 25°C |
|