ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| Nama produk |
3,5-Dibromo-4-methylphenol |
| Nama bahasa Inggris |
3,5-Dibromo-4-methylphenol; 3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| MF |
C7H6Br2O |
| Berat Molekul |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| CAS NO |
13979-81-2 |
| EINECS |
237-763-6 |
| Struktur Molekul |
|
| Kepadatan |
1.948g/cm3 |
| Titik didih |
293.1°C at 760 mmHg |
| Indeks bias |
1.626 |
| Titik nyala |
131.1°C |
| Tekanan uap |
0.00101mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
