ChemNet > CAS > 14065-32-8 metil 10-kloro-10-oksodekanoat
14065-32-8 metil 10-kloro-10-oksodekanoat
| Nama produk |
metil 10-kloro-10-oksodekanoat |
| Sinonim |
; Metil sebacoyl klorida; Asam sebacinic monomethylester monochloride |
| Nama bahasa Inggris |
methyl 10-chloro-10-oxodecanoate; Methyl sebacoyl chloride; Sebacinic acid monomethylester monochloride |
| MF |
C11H19ClO3 |
| Berat Molekul |
234.7198 |
| InChI |
InChI=1/C11H19ClO3/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3 |
| CAS NO |
14065-32-8 |
| Struktur Molekul |
|
| Kepadatan |
1.056g/cm3 |
| Titik didih |
286.3°C at 760 mmHg |
| Indeks bias |
1.449 |
| Titik nyala |
102.4°C |
| Tekanan uap |
0.00266mmHg at 25°C |
| Simbol bahaya |
C:Corrosive;
|
| Kode Risiko |
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|