1422-54-4 2-Bromo-6-fluorotoluene
Nama produk |
2-Bromo-6-fluorotoluene |
Nama bahasa Inggris |
2-Bromo-6-fluorotoluene; Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
MF |
C7H4ClFN2S |
Berat Molekul |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
CAS NO |
1422-54-4 |
Struktur Molekul |
|
Kepadatan |
1.63g/cm3 |
Titik didih |
294°C at 760 mmHg |
Indeks bias |
1.714 |
Titik nyala |
131.6°C |
Tekanan uap |
0.00166mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|