ChemNet > CAS > 1424-22-2 1-cyclohexen-1-yl acetate
1424-22-2 1-cyclohexen-1-yl acetate
Nama produk |
1-cyclohexen-1-yl acetate |
Nama bahasa Inggris |
1-cyclohexen-1-yl acetate; 1-Acetoxy-1-cyclohexene; 1-cyclohexen-1-ol, acetate; 1-CYCLOHEXENYL ACETATE; Cyclohex-1-en-1-yl acetate; Cyclohexen-1-ol acetate |
MF |
C8H12O2 |
Berat Molekul |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-7(9)10-8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
CAS NO |
1424-22-2 |
EINECS |
215-838-4 |
Struktur Molekul |
|
Kepadatan |
1g/cm3 |
Titik didih |
214.9°C at 760 mmHg |
Indeks bias |
1.467 |
Titik nyala |
79.4°C |
Tekanan uap |
0.152mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|