ChemNet > CAS > 1424-66-4 2-chloro-4-(dimethylamino)benzaldehyde
1424-66-4 2-chloro-4-(dimethylamino)benzaldehyde
| Nama produk |
2-chloro-4-(dimethylamino)benzaldehyde |
| Nama bahasa Inggris |
2-chloro-4-(dimethylamino)benzaldehyde;Benzaldehyde, 2-chloro-4-(dimethylamino)-; 2-Chloro-4-(dimethylamino)benzaldehyde; NSC 93918; 2-Chloro-4-dimethylaminobenzaldehyde |
| MF |
C9H10ClNO |
| Berat Molekul |
183.6348 |
| InChI |
InChI=1/C9H10ClNO/c1-11(2)8-4-3-7(6-12)9(10)5-8/h3-6H,1-2H3 |
| CAS NO |
1424-66-4 |
| EINECS |
215-840-5 |
| Struktur Molekul |
|
| Kepadatan |
1.215g/cm3 |
| Titik lebur |
70℃ |
| Titik didih |
309.4°C at 760 mmHg |
| Indeks bias |
1.607 |
| Titik nyala |
140.9°C |
| Tekanan uap |
0.000642mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
