ChemNet > CAS > 14282-78-1 4-methylthiophene-2-carboxylic acid
14282-78-1 4-methylthiophene-2-carboxylic acid
Nama produk |
4-methylthiophene-2-carboxylic acid |
Nama bahasa Inggris |
4-methylthiophene-2-carboxylic acid; |
MF |
C6H6O2S |
Berat Molekul |
142.1756 |
InChI |
InChI=1/C6H6O2S/c1-4-2-5(6(7)8)9-3-4/h2-3H,1H3,(H,7,8) |
CAS NO |
14282-78-1 |
Struktur Molekul |
|
Kepadatan |
1.319g/cm3 |
Titik lebur |
122℃ |
Titik didih |
277.2°C at 760 mmHg |
Indeks bias |
1.59 |
Titik nyala |
121.5°C |
Tekanan uap |
0.0022mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|