ChemNet > CAS > 1436-43-7 2-quinolinecarbonitrile
1436-43-7 2-quinolinecarbonitrile
| Nama produk |
2-quinolinecarbonitrile |
| Nama bahasa Inggris |
2-quinolinecarbonitrile; Quinoline-2-carbonitrile; 2-Cyanoquinoline |
| MF |
C10H6N2 |
| Berat Molekul |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
| CAS NO |
1436-43-7 |
| EINECS |
215-865-1 |
| Struktur Molekul |
|
| Kepadatan |
1.21g/cm3 |
| Titik lebur |
93-95℃ |
| Titik didih |
323.7°C at 760 mmHg |
| Indeks bias |
1.654 |
| Titik nyala |
115.5°C |
| Tekanan uap |
0.000258mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
