15219-34-8 Oxalyl bromide
Nama produk |
Oxalyl bromide |
Nama bahasa Inggris |
Oxalyl bromide; Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
MF |
C2Br2O2 |
Berat Molekul |
215.8282 |
InChI |
InChI=1/C2Br2O2/c3-1(5)2(4)6 |
CAS NO |
15219-34-8 |
EINECS |
239-271-7 |
Struktur Molekul |
|
Kepadatan |
2.627g/cm3 |
Titik lebur |
-19℃ |
Titik didih |
118.3°C at 760 mmHg |
Indeks bias |
1.567 |
Titik nyala |
109.8°C |
Tekanan uap |
16.8mmHg at 25°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|