1530-04-7 1,1-Diphenylhexane
Nama produk |
1,1-Diphenylhexane |
Nama bahasa Inggris |
1,1-Diphenylhexane;1,1'-hexane-1,1-diyldibenzene |
MF |
C18H22 |
Berat Molekul |
238.3673 |
InChI |
InChI=1/C18H22/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18H,2-3,6,15H2,1H3 |
CAS NO |
1530-04-7 |
Struktur Molekul |
|
Kepadatan |
0.945g/cm3 |
Titik didih |
331.4°C at 760 mmHg |
Indeks bias |
1.536 |
Titik nyala |
162.4°C |
Tekanan uap |
0.000301mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|