ChemNet > CAS > 15499-27-1 4-n-Butylchlorobenzene
15499-27-1 4-n-Butylchlorobenzene
| Nama produk |
4-n-Butylchlorobenzene |
| Nama bahasa Inggris |
4-n-Butylchlorobenzene; 1-n-Butyl-4-chlorobenzene; 4-Chloro-n-butylbenzene; 1-butyl-4-chlorobenzene |
| MF |
C10H13Cl |
| Berat Molekul |
168.6632 |
| InChI |
InChI=1/C10H13Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
| CAS NO |
15499-27-1 |
| Struktur Molekul |
|
| Kepadatan |
1.008g/cm3 |
| Titik didih |
216.6°C at 760 mmHg |
| Indeks bias |
1.509 |
| Titik nyala |
88°C |
| Tekanan uap |
0.204mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
