1551-44-6 cyclohexyl butyrate
Nama produk |
cyclohexyl butyrate |
Nama bahasa Inggris |
cyclohexyl butyrate; Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
MF |
C10H18O2 |
Berat Molekul |
170.2487 |
InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
CAS NO |
1551-44-6 |
EINECS |
216-290-9 |
Struktur Molekul |
|
Kepadatan |
0.94g/cm3 |
Titik didih |
214.9°C at 760 mmHg |
Indeks bias |
1.449 |
Titik nyala |
78°C |
Tekanan uap |
0.152mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|