ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
Nama produk |
Cyclohexanone 2,4-dinitrophenylhydrazone |
Nama bahasa Inggris |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
MF |
C12H14N4O4 |
Berat Molekul |
278.264 |
InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
CAS NO |
1589-62-4 |
EINECS |
216-458-1 |
Struktur Molekul |
|
Kepadatan |
1.47g/cm3 |
Titik lebur |
159-161℃ |
Titik didih |
434.6°C at 760 mmHg |
Indeks bias |
1.665 |
Titik nyala |
216.7°C |
Tekanan uap |
9.33E-08mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|