ChemNet > CAS > 16205-90-6 Ethyl 2-hexynoate
16205-90-6 Ethyl 2-hexynoate
Nama produk |
Ethyl 2-hexynoate |
Nama bahasa Inggris |
Ethyl 2-hexynoate; 2-Hexynoic acid ethyl ester; ethyl hex-2-ynoate |
MF |
C8H12O2 |
Berat Molekul |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3-5H2,1-2H3 |
CAS NO |
16205-90-6 |
EINECS |
240-335-1 |
Struktur Molekul |
|
Kepadatan |
0.951g/cm3 |
Titik didih |
205.1°C at 760 mmHg |
Indeks bias |
1.44 |
Titik nyala |
76.9°C |
Tekanan uap |
0.255mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|