ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
Nama produk |
Diethyl phenylphosphonite |
Nama bahasa Inggris |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
MF |
C10H15O2P |
Berat Molekul |
198.1987 |
InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
CAS NO |
1638-86-4 |
EINECS |
216-676-7 |
Struktur Molekul |
|
Titik didih |
235°C at 760 mmHg |
Titik nyala |
113°C |
Tekanan uap |
0.0784mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|