ChemNet > CAS > 1643-15-8 (m-Tolyloxy)-acetic acid
1643-15-8 (m-Tolyloxy)-acetic acid
| Nama produk |
(m-Tolyloxy)-acetic acid |
| Nama bahasa Inggris |
(m-Tolyloxy)-acetic acid; 3-Methylphenoxyacetic acid; (3-methylphenoxy)acetic acid; (3-methylphenoxy)acetate |
| MF |
C9H9O3 |
| Berat Molekul |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| CAS NO |
1643-15-8 |
| EINECS |
216-698-7 |
| Struktur Molekul |
|
| Titik didih |
300°C at 760 mmHg |
| Titik nyala |
121.4°C |
| Tekanan uap |
0.000512mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
