ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
| Nama produk |
2,6-Dimethoxybenzonitrile |
| Nama bahasa Inggris |
2,6-Dimethoxybenzonitrile;Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
| MF |
C9H9NO2 |
| Berat Molekul |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
| CAS NO |
16932-49-3 |
| EINECS |
241-000-2 |
| Struktur Molekul |
|
| Kepadatan |
1.12g/cm3 |
| Titik lebur |
119-123℃ |
| Titik didih |
306.7°C at 760 mmHg |
| Indeks bias |
1.519 |
| Titik nyala |
128.8°C |
| Tekanan uap |
0.000758mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|
