ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
Nama produk |
1,6-Diphenyl-1,3,5-hexatriene |
Nama bahasa Inggris |
1,6-Diphenyl-1,3,5-hexatriene; DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
MF |
C18H16 |
Berat Molekul |
232.3196 |
InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
CAS NO |
1720-32-7 |
EINECS |
217-011-3 |
Struktur Molekul |
|
Kepadatan |
0.988g/cm3 |
Titik lebur |
199-203℃ |
Titik didih |
361°C at 760 mmHg |
Indeks bias |
1.585 |
Titik nyala |
185.3°C |
Tekanan uap |
4.44E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|