ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| Nama produk |
2,3-Dichlorothiophene |
| Nama bahasa Inggris |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
| MF |
C4H2Cl2S |
| Berat Molekul |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| CAS NO |
17249-79-5;17249-29-5 |
| Struktur Molekul |
|
| Kepadatan |
1.488g/cm3 |
| Titik lebur |
-26℃ |
| Titik didih |
170.7°C at 760 mmHg |
| Indeks bias |
1.584 |
| Titik nyala |
68.9°C |
| Tekanan uap |
1.93mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
