ChemNet > CAS > 17277-58-6 Methyl (phenylthio)acetate
17277-58-6 Methyl (phenylthio)acetate
Nama produk |
Methyl (phenylthio)acetate |
Nama bahasa Inggris |
Methyl (phenylthio)acetate; Methyl (phenylmercapto)acetate~(Phenylthio)acetic acid methyl ester; methyl (phenylsulfanyl)acetate |
MF |
C9H10O2S |
Berat Molekul |
182.2395 |
InChI |
InChI=1/C9H10O2S/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
CAS NO |
17277-58-6 |
Struktur Molekul |
|
Kepadatan |
1.16g/cm3 |
Titik didih |
259.3°C at 760 mmHg |
Indeks bias |
1.556 |
Titik nyala |
115.3°C |
Tekanan uap |
0.013mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|