ChemNet > CAS > 17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
| Nama produk |
(2R,5R)-(-)-2,5-Hexanediol |
| Nama bahasa Inggris |
(2R,5R)-(-)-2,5-Hexanediol; (2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
| MF |
C6H14O2 |
| Berat Molekul |
118.1742 |
| InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| CAS NO |
17299-07-9 |
| Struktur Molekul |
|
| Kepadatan |
0.958g/cm3 |
| Titik lebur |
50-53℃ |
| Titik didih |
213.4°C at 760 mmHg |
| Indeks bias |
1.445 |
| Titik nyala |
101.7°C |
| Tekanan uap |
0.0364mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
