ChemNet > CAS > 17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
| Nama produk |
Ethyl 3,5-dichloro-4-hydroxybenzoate |
| Nama bahasa Inggris |
Ethyl 3,5-dichloro-4-hydroxybenzoate; 3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
| MF |
C9H8Cl2O3 |
| Berat Molekul |
235.064 |
| InChI |
InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
| CAS NO |
17302-82-8 |
| EINECS |
241-331-2 |
| Struktur Molekul |
|
| Kepadatan |
1.414g/cm3 |
| Titik lebur |
98-102℃ |
| Titik didih |
316.6°C at 760 mmHg |
| Indeks bias |
1.567 |
| Titik nyala |
145.3°C |
| Tekanan uap |
0.000219mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
