ChemNet > CAS > 175134-98-2 N-(3-Cyanophenyl)pyrrole
175134-98-2 N-(3-Cyanophenyl)pyrrole
Nama produk |
N-(3-Cyanophenyl)pyrrole |
Nama bahasa Inggris |
N-(3-Cyanophenyl)pyrrole; 3-(1-Pyrrolo)benzonitrile; 3-(1H-pyrrol-1-yl)benzonitrile |
MF |
C11H8N2 |
Berat Molekul |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H |
CAS NO |
175134-98-2 |
Struktur Molekul |
|
Kepadatan |
1.05g/cm3 |
Titik didih |
306.3°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
139.1°C |
Tekanan uap |
0.000776mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|