ChemNet > CAS > 175135-22-5 2-(n-Propylthio)nicotinic acid
175135-22-5 2-(n-Propylthio)nicotinic acid
Nama produk |
2-(n-Propylthio)nicotinic acid |
Nama bahasa Inggris |
2-(n-Propylthio)nicotinic acid; 2-(n-Propylmercapto)nicotinic acid~2-(n-Propylthio)pyridine-3-carboxylic acid; 2-(propylsulfanyl)pyridine-3-carboxylic acid; 2-(propylsulfanyl)pyridine-3-carboxylate |
MF |
C9H10NO2S |
Berat Molekul |
196.2467 |
InChI |
InChI=1/C9H11NO2S/c1-2-6-13-8-7(9(11)12)4-3-5-10-8/h3-5H,2,6H2,1H3,(H,11,12)/p-1 |
CAS NO |
175135-22-5 |
Struktur Molekul |
|
Titik lebur |
161-162℃ |
Titik didih |
349.1°C at 760 mmHg |
Titik nyala |
164.9°C |
Tekanan uap |
1.8E-05mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|