18031-40-8;2111-75-3 L(-)-Perillaldehyde
Nama produk |
L(-)-Perillaldehyde |
Nama bahasa Inggris |
L(-)-Perillaldehyde; L-4(1-Methylethenyl)-1-cyclohexene-1-carboxaldehyde; (-)-Perillaaldehyde; 1-methoxy-2,3,5-trimethylbenzene; (4S)-4-(1-methylethenyl)cyclohex-1-ene-1-carbaldehyde; (-)-Perillaldehyde; L-perillaldehyde; ; 4-isopropenylcyclohex-1-enecarbaldehyde; 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde; Perilla aldehyde |
MF |
C10H14O |
Berat Molekul |
150.2176 |
InChI |
InChI=1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1 |
CAS NO |
18031-40-8;2111-75-3 |
EINECS |
243-843-1;218-302-8 |
Struktur Molekul |
|
Kepadatan |
1.002g/cm3 |
Titik didih |
238°C at 760 mmHg |
Indeks bias |
1.543 |
Titik nyala |
95.6°C |
Tekanan uap |
0.0434mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|