1817-47-6 4-Isopropylnitrobenzene
Nama produk |
4-Isopropylnitrobenzene |
Nama bahasa Inggris |
4-Isopropylnitrobenzene; 4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene; 1-nitro-4-(propan-2-yl)benzene |
MF |
C9H11NO2 |
Berat Molekul |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
CAS NO |
1817-47-6 |
EINECS |
217-326-6 |
Struktur Molekul |
|
Kepadatan |
1.091g/cm3 |
Titik didih |
236.4°C at 760 mmHg |
Indeks bias |
1.533 |
Titik nyala |
99.9°C |
Tekanan uap |
0.0728mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|