ChemNet > CAS > 18856-63-8 4-Ethylphenyl isothiocyanate
18856-63-8 4-Ethylphenyl isothiocyanate
| Nama produk |
4-Ethylphenyl isothiocyanate |
| Nama bahasa Inggris |
4-Ethylphenyl isothiocyanate; 4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| MF |
C9H9NS |
| Berat Molekul |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| CAS NO |
18856-63-8 |
| Struktur Molekul |
|
| Kepadatan |
1.01g/cm3 |
| Titik didih |
257.8°C at 760 mmHg |
| Indeks bias |
1.553 |
| Titik nyala |
110.2°C |
| Tekanan uap |
0.0229mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
