ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
Nama produk |
Methyl 3-methoxyphenylacetate |
Nama bahasa Inggris |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
MF |
C10H12O3 |
Berat Molekul |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
CAS NO |
18927-05-4 |
Struktur Molekul |
|
Kepadatan |
1.083g/cm3 |
Titik didih |
254°C at 760 mmHg |
Indeks bias |
1.499 |
Titik nyala |
100.2°C |
Tekanan uap |
0.0176mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|