ChemNet > CAS > 190661-29-1 (2-Benzyloxyphenyl)boronic acid
190661-29-1 (2-Benzyloxyphenyl)boronic acid
| Nama produk |
(2-Benzyloxyphenyl)boronic acid |
| Nama bahasa Inggris |
(2-Benzyloxyphenyl)boronic acid; 2-Benzyloxyphenylboronic acid; 2-Benzyloxybenzeneboronic acid; 2-Phenylmethoxy Phenylboronic Acid |
| MF |
C13H13BO3 |
| Berat Molekul |
228.0515 |
| InChI |
InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2 |
| CAS NO |
190661-29-1 |
| Struktur Molekul |
|
| Kepadatan |
1.2g/cm3 |
| Titik lebur |
105-110℃ |
| Titik didih |
428.7°C at 760 mmHg |
| Indeks bias |
1.593 |
| Titik nyala |
213°C |
| Tekanan uap |
4.13E-08mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
