ChemNet > CAS > 19234-20-9 (2-Isopropoxyethyl) asetat
19234-20-9 (2-Isopropoxyethyl) asetat
Nama produk |
(2-Isopropoxyethyl) asetat |
Sinonim |
;Isopropilglikol asetat; Etilenglikol monoisopropil eter asetat; 2- (propan-2-yloxy) etil asetat |
Nama bahasa Inggris |
(2-Isopropoxyethyl) acetate; Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
MF |
C7H14O3 |
Berat Molekul |
146.1843 |
InChI |
InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
CAS NO |
19234-20-9 |
EINECS |
242-901-3 |
Struktur Molekul |
|
Kepadatan |
0.947g/cm3 |
Titik didih |
177.6°C at 760 mmHg |
Indeks bias |
1.406 |
Titik nyala |
56.8°C |
Tekanan uap |
1.03mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R10:Flammable.;
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|