ChemNet > CAS > 195383-80-3 2-Bromo-4,5-asam dimetoksisinnamat
195383-80-3 2-Bromo-4,5-asam dimetoksisinnamat
| Nama produk |
2-Bromo-4,5-asam dimetoksisinnamat |
| Sinonim |
(2E)-3-(2-bromo-4,5-dimetoksifenil)prop-2-enoat |
| Nama bahasa Inggris |
2-Bromo-4,5-dimethoxycinnamic acid;(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
| MF |
C11H10BrO4 |
| Berat Molekul |
286.0992 |
| InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
| CAS NO |
195383-80-3 |
| Struktur Molekul |
|
| Titik lebur |
253-254℃ |
| Titik didih |
409.5°C at 760 mmHg |
| Titik nyala |
201.4°C |
| Tekanan uap |
1.94E-07mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|