ChemNet > CAS > 1984-59-4 2,3-Dichloroanisole
1984-59-4 2,3-Dichloroanisole
| Nama produk |
2,3-Dichloroanisole |
| Nama bahasa Inggris |
2,3-Dichloroanisole; 1,2-Dichloro-3-methoxybenzene; ; 1,2-dichloro-3-methoxybenzene |
| MF |
C7H6Cl2O |
| Berat Molekul |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
| CAS NO |
1984-59-4 |
| EINECS |
217-853-1 |
| Struktur Molekul |
|
| Kepadatan |
1.289g/cm3 |
| Titik lebur |
30-35℃ |
| Titik didih |
223.4°C at 760 mmHg |
| Indeks bias |
1.534 |
| Titik nyala |
94.7°C |
| Tekanan uap |
0.144mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
