ChemNet > CAS > 2001-93-6 Dithiouracil
2001-93-6 Dithiouracil
| Nama produk |
Dithiouracil |
| Nama bahasa Inggris |
Dithiouracil; 2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
| MF |
C4H4N2S2 |
| Berat Molekul |
144.218 |
| InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| CAS NO |
2001-93-6 |
| EINECS |
217-894-5 |
| Struktur Molekul |
|
| Kepadatan |
1.5g/cm3 |
| Titik lebur |
279-281℃ |
| Titik didih |
225.6°C at 760 mmHg |
| Indeks bias |
1.776 |
| Titik nyala |
90.3°C |
| Tekanan uap |
0.0855mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
