20099-89-2 Cyanophenacylbromide
Nama produk |
Cyanophenacylbromide |
Nama bahasa Inggris |
Cyanophenacylbromide; 4-Cyanophenacyl bromide; 2-Bromo-4-cyanoacetophenone; 4-(2-Bromoacetyl)benzonitrile; 4-(bromoacetyl)benzonitrile; 2-Bromo-4'-cyanoacetophenone; 2-Bromo-4'-cyano acetophenone |
MF |
C10H7BrO |
Berat Molekul |
223.066 |
InChI |
InChI=1/C10H7BrO/c1-2-8-3-5-9(6-4-8)10(12)7-11/h1,3-6H,7H2 |
CAS NO |
20099-89-2 |
Struktur Molekul |
|
Titik lebur |
92-96℃ |
Indeks bias |
1.59 |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|