589-98-0;20296-29-1 3-Octanol
Nama produk |
3-Octanol |
Nama bahasa Inggris |
3-Octanol; DL-3-Octanol; ethylpentylcarbinol; n-Amyl ethyl carbinol; Ethyl n-pentyl carbinol; (3S)-octan-3-ol; (±)-octan-3-ol; (3R)-octan-3-ol |
MF |
C8H18O |
Berat Molekul |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
CAS NO |
589-98-0;20296-29-1 |
EINECS |
209-667-4 |
Struktur Molekul |
|
Kepadatan |
0.821g/cm3 |
Titik lebur |
-45℃ |
Titik didih |
169°C at 760 mmHg |
Indeks bias |
1.426 |
Titik nyala |
65.6°C |
Tekanan uap |
0.512mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|