ChemNet > CAS > 207981-48-4 2,3-difluorocinnamic acid
207981-48-4 2,3-difluorocinnamic acid
Nama produk |
2,3-difluorocinnamic acid |
Nama bahasa Inggris |
2,3-difluorocinnamic acid;(2E)-3-(2,3-difluorophenyl)prop-2-enoic acid; (2E)-3-(2,3-difluorophenyl)prop-2-enoate |
MF |
C9H5F2O2 |
Berat Molekul |
183.1322 |
InChI |
InChI=1/C9H6F2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
CAS NO |
207981-48-4 |
Struktur Molekul |
|
Titik didih |
281.3°C at 760 mmHg |
Titik nyala |
124°C |
Tekanan uap |
0.0017mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|