ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
| Nama produk |
Methyl 3,4-dihydroxybenzoate |
| Nama bahasa Inggris |
Methyl 3,4-dihydroxybenzoate; 3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
| MF |
C8H8O4 |
| Berat Molekul |
168.1467 |
| InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| CAS NO |
2150-43-8 |
| Struktur Molekul |
|
| Kepadatan |
1.354g/cm3 |
| Titik didih |
351.5°C at 760 mmHg |
| Indeks bias |
1.587 |
| Titik nyala |
148.5°C |
| Tekanan uap |
2.02E-05mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
