ChemNet > CAS > 2156-04-9 4-Vinylbenzeneboronic acid
2156-04-9 4-Vinylbenzeneboronic acid
Nama produk |
4-Vinylbenzeneboronic acid |
Nama bahasa Inggris |
4-Vinylbenzeneboronic acid; 4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
MF |
C8H9BO2 |
Berat Molekul |
147.9669 |
InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
CAS NO |
2156-04-9 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik lebur |
188-189℃ |
Titik didih |
306.2°C at 760 mmHg |
Indeks bias |
1.539 |
Titik nyala |
139°C |
Tekanan uap |
0.000341mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|