21906-32-1 3-Bromophenylacetone
Nama produk |
3-Bromophenylacetone |
Nama bahasa Inggris |
3-Bromophenylacetone; 3-bromophenylacetonone; 1-(3-bromophenyl)propan-2-one |
MF |
C9H9BrO |
Berat Molekul |
213.0712 |
InChI |
InChI=1/C9H9BrO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
CAS NO |
21906-32-1 |
Struktur Molekul |
|
Kepadatan |
1.401g/cm3 |
Titik didih |
265.7°C at 760 mmHg |
Indeks bias |
1.546 |
Titik nyala |
75.9°C |
Tekanan uap |
0.00903mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|