ChemNet > CAS > 2211-94-1 2,3-Epoxypropyl-4'-methoxyphenyl ether
2211-94-1 2,3-Epoxypropyl-4'-methoxyphenyl ether
| Nama produk |
2,3-Epoxypropyl-4'-methoxyphenyl ether |
| Nama bahasa Inggris |
2,3-Epoxypropyl-4'-methoxyphenyl ether; Glycidyl p-methoxyphenyl ether; 2,3-epoxypropyl-4-methoxyphenyl ether; 2-[(4-methoxyphenoxy)methyl]oxirane; (2R)-2-[(4-methoxyphenoxy)methyl]oxirane; (2S)-2-[(4-methoxyphenoxy)methyl]oxirane |
| MF |
C10H12O3 |
| Berat Molekul |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-11-8-2-4-9(5-3-8)12-6-10-7-13-10/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| CAS NO |
2211-94-1 |
| EINECS |
218-653-7 |
| Struktur Molekul |
|
| Kepadatan |
1.142g/cm3 |
| Titik lebur |
45-48℃ |
| Titik didih |
287.9°C at 760 mmHg |
| Indeks bias |
1.526 |
| Titik nyala |
95.5°C |
| Tekanan uap |
0.00417mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|
