ChemNet > CAS > 22590-64-3 3- (oxiran-2-ylmethoxy) benzaldehida
22590-64-3 3- (oxiran-2-ylmethoxy) benzaldehida
| Nama produk |
3- (oxiran-2-ylmethoxy) benzaldehida |
| Nama bahasa Inggris |
3-(oxiran-2-ylmethoxy)benzaldehyde; |
| MF |
C10H10O3 |
| Berat Molekul |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| CAS NO |
22590-64-3 |
| Struktur Molekul |
|
| Kepadatan |
1.225g/cm3 |
| Titik didih |
318.2°C at 760 mmHg |
| Indeks bias |
1.581 |
| Titik nyala |
137.2°C |
| Tekanan uap |
0.000367mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
