ChemNet > CAS > 2293-07-4 1-(4-methoxyphenyl)-2-thiourea
2293-07-4 1-(4-methoxyphenyl)-2-thiourea
| Nama produk |
1-(4-methoxyphenyl)-2-thiourea |
| Nama bahasa Inggris |
1-(4-methoxyphenyl)-2-thiourea; 4-Methoxyphenylthiourea; 1-(4-methoxyphenyl)thiourea |
| MF |
C8H10N2OS |
| Berat Molekul |
182.2428 |
| InChI |
InChI=1/C8H10N2OS/c1-11-7-4-2-6(3-5-7)10-8(9)12/h2-5H,1H3,(H3,9,10,12) |
| CAS NO |
2293-07-4 |
| EINECS |
218-931-8 |
| Struktur Molekul |
|
| Kepadatan |
1.287g/cm3 |
| Titik lebur |
212℃ |
| Titik didih |
311°C at 760 mmHg |
| Indeks bias |
1.677 |
| Titik nyala |
141.9°C |
| Tekanan uap |
0.00058mmHg at 25°C |
| Simbol bahaya |
 T:Toxic;
|
| Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
