ChemNet > CAS > 2349-58-8 4,5-Diphenyl-2-imidazolethiol
2349-58-8 4,5-Diphenyl-2-imidazolethiol
Nama produk |
4,5-Diphenyl-2-imidazolethiol |
Nama bahasa Inggris |
4,5-Diphenyl-2-imidazolethiol; 2,3-Diphenyl-1-indenone; 4,5-diphenyl-1,3-dihydro-2H-imidazole-2-thione |
MF |
C15H12N2S |
Berat Molekul |
252.3342 |
InChI |
InChI=1/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
CAS NO |
2349-58-8 |
EINECS |
219-077-9 |
Struktur Molekul |
|
Kepadatan |
1.29g/cm3 |
Titik lebur |
300℃ |
Titik didih |
407.5°C at 760 mmHg |
Indeks bias |
1.724 |
Titik nyala |
200.3°C |
Tekanan uap |
7.51E-07mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|