2350-89-2 4-Vinylbiphenyl
Nama produk |
4-Vinylbiphenyl |
Nama bahasa Inggris |
4-Vinylbiphenyl; 4-Phenylstyrene; 4-ethenylbiphenyl |
MF |
C14H12 |
Berat Molekul |
180.2451 |
InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
CAS NO |
2350-89-2 |
EINECS |
219-082-6 |
Struktur Molekul |
|
Kepadatan |
0.997g/cm3 |
Titik lebur |
115-121℃ |
Titik didih |
301.7°C at 760 mmHg |
Indeks bias |
1.599 |
Titik nyala |
139.4°C |
Tekanan uap |
0.00185mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|